cas: 20934-81-0 — see every product listed under this CAS number, including other names
4-Benzooxazol-2-yl-phenylamine, 98% (CAS 20934-81-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030006-1G |
| cas | 20934-81-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 596.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(1,3-benzoxazol-2-yl)aniline (CAS 20934-81-0) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 4-(1,3-benzoxazol-2-yl)aniline. InChIKey: XZYQBYQGHHGXBC-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-(1,3-benzoxazol-2-yl)aniline |
| InChIKey | XZYQBYQGHHGXBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)