4-(CYCLOPROPYLSULFONYL)ANILINE, 98%
cas: 1147558-13-1 — see every product listed under this CAS number, including other names
4-(CYCLOPROPYLSULFONYL)ANILINE, 98% (CAS 1147558-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F301749-100MG |
| cas | 1147558-13-1 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 5g | 5074.27 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1104.63 Pln | |
| Ambeed | 5g | 3474.25 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 4893.20 Pln | |
| BLDpharm | 100mg | 297.70 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1180.72 Pln | |
| BLDpharm | 5g | 3740.93 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-cyclopropylsulfonylaniline (CAS 1147558-13-1) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 4-cyclopropylsulfonylaniline. InChIKey: JRPZKEUELSTMFP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 4-cyclopropylsulfonylaniline |
| InChIKey | JRPZKEUELSTMFP-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)