CAS 23822-07-3 is the registry number for 2,4-Dimethoxythiobenzamide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
2,4-dimethoxybenzenecarbothioamide (CAS 23822-07-3) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 2,4-dimethoxybenzenecarbothioamide. InChIKey: KYGPUPQKDUNOLW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2,4-dimethoxybenzenecarbothioamide |
| InChIKey | KYGPUPQKDUNOLW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=S)N)OC |
Computed by PubChem (NCBI)