CAS 5825-63-8 is the registry number for 1-Methanesulfonylindoline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-methylsulfonyl-2,3-dihydroindole (CAS 5825-63-8) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-methylsulfonyl-2,3-dihydroindole. InChIKey: UTGYXFSLMMMLAZ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1-methylsulfonyl-2,3-dihydroindole |
| InChIKey | UTGYXFSLMMMLAZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=CC=CC=C21 |
Computed by PubChem (NCBI)