CAS 1206970-11-7 appears in our catalog under these names: 3-(Benzenesulfonyl)azetidine hydrochloride, 96%, 3-(Benzenesulfonyl)azetidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(benzenesulfonyl)azetidine (CAS 1206970-11-7) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 3-(benzenesulfonyl)azetidine. InChIKey: ZAKRJACOZVLRFD-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 3-(benzenesulfonyl)azetidine |
| InChIKey | ZAKRJACOZVLRFD-UHFFFAOYSA-N |
| SMILES | C1C(CN1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)