CAS 3634-89-7 appears in our catalog under these names: N-Tosylaziridine, 97%, N–Tosylaziridine, 1-Tosylaziridine, >98.0%(HPLC)(qNMR), 1-Tosylaziridine 98%, N-TOSYLAZIRIDINE. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 100g, 10g, 1g, 200mg, 250mg, 50g.
1-(4-methylphenyl)sulfonylaziridine (CAS 3634-89-7) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylaziridine. InChIKey: VBNWSEVVMYMVLC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | VBNWSEVVMYMVLC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2 |
Computed by PubChem (NCBI)