CAS 25069-86-7 appears in our catalog under these names: 4–(Diphenylamino)phenol, 4-(DIphenylamino)phenol, 95%, 95%, 4-(Diphenylamino)phenol, 98%, 4-(DIphenylamino)phenol, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-(N-phenylanilino)phenol (CAS 25069-86-7) is a chemical compound with the molecular formula C18H15NO and a molecular weight of 261.3 g/mol. IUPAC name: 4-(N-phenylanilino)phenol. InChIKey: SZNBBGIZLQDSGC-UHFFFAOYSA-N.
| Molecular formula | C18H15NO |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 4-(N-phenylanilino)phenol |
| InChIKey | SZNBBGIZLQDSGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)