CAS 50432-01-4 appears in our catalog under these names: 4–Amino–2,6–diphenylphenol, 4-Amino-2,6-diphenylphenol, 95%, 4-Amino-2,6-diphenylphenol, >98.0%(GC)(T), 5'-Amino-[1,1':3',1''-terphenyl]-2'-ol, 98%+, 98%+, 5'-Amino-[1,1':3',1''-terphenyl]-2'-ol, 98%+(HPLC),RG. Offered by: GLPBio, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
4-amino-2,6-diphenylphenol (CAS 50432-01-4) is a chemical compound with the molecular formula C18H15NO and a molecular weight of 261.3 g/mol. IUPAC name: 4-amino-2,6-diphenylphenol. InChIKey: YCOUFOVMXBWYIX-UHFFFAOYSA-N.
| Molecular formula | C18H15NO |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 4-amino-2,6-diphenylphenol |
| InChIKey | YCOUFOVMXBWYIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2O)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)