CAS 134285-24-8 is the registry number for 6-Phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-phenyl-2,3,4,9-tetrahydrocarbazol-1-one (CAS 134285-24-8) is a chemical compound with the molecular formula C18H15NO and a molecular weight of 261.3 g/mol. IUPAC name: 6-phenyl-2,3,4,9-tetrahydrocarbazol-1-one. InChIKey: RITRQULPLLALLS-UHFFFAOYSA-N.
| Molecular formula | C18H15NO |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 6-phenyl-2,3,4,9-tetrahydrocarbazol-1-one |
| InChIKey | RITRQULPLLALLS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)NC3=C2C=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)