Products 107396-23-6
CAS 107396-23-6 is the registry number for 3-(Diphenylamino)phenol, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 500mg, 250mg.
3-(N-phenylanilino)phenol (CAS 107396-23-6) is a chemical compound with the molecular formula C18H15NO and a molecular weight of 261.3 g/mol. IUPAC name: 3-(N-phenylanilino)phenol. InChIKey: PLALNMFIFWIUFQ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 3-(N-phenylanilino)phenol |
| InChIKey | PLALNMFIFWIUFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)