CAS 6628-69-9 is the registry number for 4-([1,1'-Biphenyl]-4-yloxy)aniline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-phenylphenoxy)aniline (CAS 6628-69-9) is a chemical compound with the molecular formula C18H15NO and a molecular weight of 261.3 g/mol. IUPAC name: 4-(4-phenylphenoxy)aniline. InChIKey: JSKKUFIMCFTTRV-UHFFFAOYSA-N.
| Molecular formula | C18H15NO |
|---|---|
| Molecular weight | 261.3 g/mol |
| IUPAC name | 4-(4-phenylphenoxy)aniline |
| InChIKey | JSKKUFIMCFTTRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)