cas: 71145-96-5 — see every product listed under this CAS number, including other names
4-(Dimethylamino)-3-(trifluoromethyl)benzonitrile, 95% (CAS 71145-96-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1234149-10g |
| cas | 71145-96-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 3689.56 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1309.97 Pln | |
| Fluorochem | 10g | 2398.13 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1158.80 Pln | |
| Chemat | 10g | 1888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(dimethylamino)-3-(trifluoromethyl)benzonitrile (CAS 71145-96-5) is a chemical compound with the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. IUPAC name: 4-(dimethylamino)-3-(trifluoromethyl)benzonitrile. InChIKey: UUKQLJHJAVCMSX-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 4-(dimethylamino)-3-(trifluoromethyl)benzonitrile |
| InChIKey | UUKQLJHJAVCMSX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)