Products 467457-23-4
CAS 467457-23-4 is the registry number for 2-(5,6,7-Trifluoro-1H-indol-3-yl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(5,6,7-trifluoro-1H-indol-3-yl)ethanamine (CAS 467457-23-4) is a chemical compound with the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. IUPAC name: 2-(5,6,7-trifluoro-1H-indol-3-yl)ethanamine. InChIKey: CVQWCGCDFNERKS-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 2-(5,6,7-trifluoro-1H-indol-3-yl)ethanamine |
| InChIKey | CVQWCGCDFNERKS-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CNC2=C(C(=C1F)F)F)CCN |
Computed by PubChem (NCBI)