Products 126954-11-8
CAS 126954-11-8 appears in our catalog under these names: 2,2,2-Trifluoro-1-(1h-indol-3-yl)ethan-1-amine, 95%, 2,2,2-Trifluoro-1-(1H-indol-3-yl)ethan-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine (CAS 126954-11-8) is a chemical compound with the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine. InChIKey: TZQBOSKCYLEGAX-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1H-indol-3-yl)ethanamine |
| InChIKey | TZQBOSKCYLEGAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C(F)(F)F)N |
Computed by PubChem (NCBI)