CAS 63815-72-5 is the registry number for 1,2-Dimethyl-5-(trifluoromethyl)-1H-benzo[d]imidazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1,2-dimethyl-5-(trifluoromethyl)benzimidazole (CAS 63815-72-5) is a chemical compound with the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. IUPAC name: 1,2-dimethyl-5-(trifluoromethyl)benzimidazole. InChIKey: QIOYCRVQIQHGRR-UHFFFAOYSA-N.
| Molecular formula | C10H9F3N2 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 1,2-dimethyl-5-(trifluoromethyl)benzimidazole |
| InChIKey | QIOYCRVQIQHGRR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)