CAS 2641906-59-2 is the registry number for (S)-2-(3-(1-Aminoethyl)-2-fluorophenyl)-2,2-difluoroacetonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-[(1S)-1-aminoethyl]-2-fluorophenyl]-2,2-difluoroacetonitrile (CAS 2641906-59-2) is a chemical compound with the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. IUPAC name: 2-[3-[(1S)-1-aminoethyl]-2-fluorophenyl]-2,2-difluoroacetonitrile. InChIKey: ZEXJBKNYRCMIGC-LURJTMIESA-N.
| Molecular formula | C10H9F3N2 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 2-[3-[(1S)-1-aminoethyl]-2-fluorophenyl]-2,2-difluoroacetonitrile |
| InChIKey | ZEXJBKNYRCMIGC-LURJTMIESA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)C(C#N)(F)F)F)N |
Computed by PubChem (NCBI)