cas: 34403-52-6 — see every product listed under this CAS number, including other names
4-(Dimethylamino)benzylamine dihydrochloride, 97% (CAS 34403-52-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092985-5G |
| cas | 34403-52-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 482.14 Pln | |
| Fluorochem | 25g | 2101.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(aminomethyl)-N,N-dimethylaniline;dihydrochloride (CAS 34403-52-6) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: 4-(aminomethyl)-N,N-dimethylaniline;dihydrochloride. InChIKey: NRZQHDOWSPJUQW-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-dimethylaniline;dihydrochloride |
| InChIKey | NRZQHDOWSPJUQW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)