CAS 1269199-29-2 is the registry number for N1,N1,4-Trimethyl-1,2-benzenediamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
1-N,1-N,4-trimethylbenzene-1,2-diamine;dihydrochloride (CAS 1269199-29-2) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: 1-N,1-N,4-trimethylbenzene-1,2-diamine;dihydrochloride. InChIKey: FQBHNXPSUBEERO-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | 1-N,1-N,4-trimethylbenzene-1,2-diamine;dihydrochloride |
| InChIKey | FQBHNXPSUBEERO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)