CAS 34403-52-6 appears in our catalog under these names: 4-Dimethylaminobenzylamine dihydrochloride, 95%, 4-Dimethylaminobenzylamine Dihydrochloride, >95% (HPLC), 4–Dimethylaminobenzylamine Dihydrochloride, 4-Dimethylaminobenzylamine dihydrochloride, 4-Dimethylaminobenzylamine Dihydrochloride, >98.0%(T). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 5g, 50g, 2g, 10g, 250mg.
4-(aminomethyl)-N,N-dimethylaniline;dihydrochloride (CAS 34403-52-6) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: 4-(aminomethyl)-N,N-dimethylaniline;dihydrochloride. InChIKey: NRZQHDOWSPJUQW-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-dimethylaniline;dihydrochloride |
| InChIKey | NRZQHDOWSPJUQW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)