Products 1956307-03-1

CAS 1956307-03-1 is the registry number for 3-(4-Methyl-pyridin-2-yl)-propylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-methyl-2-pyridinyl)propan-1-amine;dihydrochloride (CAS 1956307-03-1) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: 3-(4-methyl-2-pyridinyl)propan-1-amine;dihydrochloride. InChIKey: RZLRYRUBGKCYSN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16Cl2N2
Molecular weight223.14 g/mol
IUPAC name3-(4-methyl-2-pyridinyl)propan-1-amine;dihydrochloride
InChIKeyRZLRYRUBGKCYSN-UHFFFAOYSA-N
SMILESCC1=CC(=NC=C1)CCCN.Cl.Cl

Computed by PubChem (NCBI)