CAS 72954-99-5 appears in our catalog under these names: [2-Methyl-1-(3-pyridinyl)propyl]amine dihydrochloride, 95%, (2–Methyl–1–(3–pyridinyl)propyl)amine dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-methyl-1-pyridin-3-ylpropan-1-amine;dihydrochloride (CAS 72954-99-5) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: 2-methyl-1-pyridin-3-ylpropan-1-amine;dihydrochloride. InChIKey: HRPFEVDYCALKLE-UHFFFAOYSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | 2-methyl-1-pyridin-3-ylpropan-1-amine;dihydrochloride |
| InChIKey | HRPFEVDYCALKLE-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CN=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)