cas: 833-39-6 — see every product listed under this CAS number, including other names
4-(Hydroxy(phenyl)methyl)phenol 95% (CAS 833-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A798596-100mg |
| cas | 833-39-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 470.50 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1883.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A798596 |
4-[hydroxy(phenyl)methyl]phenol (CAS 833-39-6) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 4-[hydroxy(phenyl)methyl]phenol. InChIKey: QATSOLLSVDVSAL-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-[hydroxy(phenyl)methyl]phenol |
| InChIKey | QATSOLLSVDVSAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)