cas: 19672-49-2 — see every product listed under this CAS number, including other names
4-(Hydroxydiphenylmethyl)benzoic acid, 98%, 98% (CAS 19672-49-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K95-10g |
| cas | 19672-49-2 |
| size | 10g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 832.40 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 515.60 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[hydroxy(diphenyl)methyl]benzoic acid (CAS 19672-49-2) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 4-[hydroxy(diphenyl)methyl]benzoic acid. InChIKey: CPZWBWPALJLUBJ-UHFFFAOYSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 4-[hydroxy(diphenyl)methyl]benzoic acid |
| InChIKey | CPZWBWPALJLUBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)