CAS 1206102-05-7 appears in our catalog under these names: 3-Benzyloxy-2-styryl-pyran-4-one, 95%, 2-((1E)-2-Phenylethenyl)-3-(phenylmethoxy)-4H-pyran-4-one. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 5g, 100mg, 25mg.
2-[(E)-2-phenylethenyl]-3-phenylmethoxypyran-4-one (CAS 1206102-05-7) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 2-[(E)-2-phenylethenyl]-3-phenylmethoxypyran-4-one. InChIKey: GRNZXGRTBJGQGT-VAWYXSNFSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 2-[(E)-2-phenylethenyl]-3-phenylmethoxypyran-4-one |
| InChIKey | GRNZXGRTBJGQGT-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(OC=CC2=O)/C=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)