CAS 122294-08-0 is the registry number for 4-(3-Benzyloxyphenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3-phenylmethoxyphenyl)benzoic acid (CAS 122294-08-0) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 4-(3-phenylmethoxyphenyl)benzoic acid. InChIKey: FLCMCDSGSVDXBP-UHFFFAOYSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 4-(3-phenylmethoxyphenyl)benzoic acid |
| InChIKey | FLCMCDSGSVDXBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)