Products 1955523-72-4

CAS 1955523-72-4 is the registry number for 1-(2-Hydroxynaphthalen-1-yl)naphthalen-2-ol hydrate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;hydrate (CAS 1955523-72-4) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;hydrate. InChIKey: PWLMWGXFTDKMAL-UHFFFAOYSA-N.

Identity
Molecular formulaC20H16O3
Molecular weight304.3 g/mol
IUPAC name1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;hydrate
InChIKeyPWLMWGXFTDKMAL-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)O.O

Computed by PubChem (NCBI)