CAS 1955523-72-4 is the registry number for 1-(2-Hydroxynaphthalen-1-yl)naphthalen-2-ol hydrate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;hydrate (CAS 1955523-72-4) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;hydrate. InChIKey: PWLMWGXFTDKMAL-UHFFFAOYSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;hydrate |
| InChIKey | PWLMWGXFTDKMAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)O.O |
Computed by PubChem (NCBI)