CAS 893736-32-8 appears in our catalog under these names: 2-(3-Benzyloxyphenyl)benzoic acid, 95%, 3'-(Benzyloxy)-(1,1'-biphenyl)-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(3-phenylmethoxyphenyl)benzoic acid (CAS 893736-32-8) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 2-(3-phenylmethoxyphenyl)benzoic acid. InChIKey: BFTHGUZZCJYQOM-UHFFFAOYSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 2-(3-phenylmethoxyphenyl)benzoic acid |
| InChIKey | BFTHGUZZCJYQOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)