CAS 485769-38-8 is the registry number for 4-(2,3-Dihydro-1H-indol-1-ylsulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid (CAS 485769-38-8) is a chemical compound with the molecular formula C15H13NO4S and a molecular weight of 303.3 g/mol. IUPAC name: 4-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid. InChIKey: KEIMROLKEASOFU-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4S |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 4-(2,3-dihydroindol-1-ylsulfonyl)benzoic acid |
| InChIKey | KEIMROLKEASOFU-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)