CAS 182145-44-4 appears in our catalog under these names: N-(4-Methylphenylsulfonyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one, 98%, 98%, N-(4-Methylphenylsulfonyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one (CAS 182145-44-4) is a chemical compound with the molecular formula C15H13NO4S and a molecular weight of 303.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one. InChIKey: JXVKKFZWABUXGL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4S |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-4H-3,1-benzoxazin-2-one |
| InChIKey | JXVKKFZWABUXGL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3=CC=CC=C3COC2=O |
Computed by PubChem (NCBI)