cas: 4461-38-5 — see every product listed under this CAS number, including other names
4-(Methylsulfonyl)benzamide, 97% (CAS 4461-38-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068322-1G |
| cas | 4461-38-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1101.71 Pln | |
| Fluorochem | 5g | 3012.50 Pln | |
| Fluorochem | 25g | 8588.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-methylsulfonylbenzamide (CAS 4461-38-5) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 4-methylsulfonylbenzamide. InChIKey: LHKNFPQRVQCNQY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 4-methylsulfonylbenzamide |
| InChIKey | LHKNFPQRVQCNQY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)N |
Computed by PubChem (NCBI)