CAS 68158-15-6 appears in our catalog under these names: 4-Acetyl-thiazole-2-carboxylic acid ethyl ester, 95%, Ethyl 4-acetylthiazole-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Ethyl 4-acetyl-1,3-thiazole-2-carboxylate (CAS 68158-15-6) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: ethyl 4-acetyl-1,3-thiazole-2-carboxylate. InChIKey: ZETZPNRKYZHVSJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | ethyl 4-acetyl-1,3-thiazole-2-carboxylate |
| InChIKey | ZETZPNRKYZHVSJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C(=O)C |
Computed by PubChem (NCBI)