CAS 112894-47-0 appears in our catalog under these names: 2,3-Dihydro-1-benzofuran-5-sulfonamide, 95%, 2,3-Dihydro-1-benzofuran-5-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 10g, 1g, 2,5g.
2,3-dihydro-1-benzofuran-5-sulfonamide (CAS 112894-47-0) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 2,3-dihydro-1-benzofuran-5-sulfonamide. InChIKey: YSWWLKULIVOPEP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 2,3-dihydro-1-benzofuran-5-sulfonamide |
| InChIKey | YSWWLKULIVOPEP-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)