Products 2163783-67-1
CAS 2163783-67-1 is the registry number for 2-[(Thien-2-ylcarbonyl)amino]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(thiophene-2-carbonylamino)propanoic acid (CAS 2163783-67-1) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 2-(thiophene-2-carbonylamino)propanoic acid. InChIKey: WJCDNMHHSJZLOQ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 2-(thiophene-2-carbonylamino)propanoic acid |
| InChIKey | WJCDNMHHSJZLOQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)C1=CC=CS1 |
Computed by PubChem (NCBI)
Synonyms:
2-[(thiophen-2-yl)formamido]propanoic acid, 2-(thiophene-2-carbonylamino)propanoic Acid, 2-[(thien-2-ylcarbonyl)amino]propanoic acid, 2-(thiophen-2-ylformamido)propanoic acid, (Thiophene-2-carbonyl)alanine, starbld0040727, Oprea1_400396, N-(thiophen-2-ylcarbonyl)alanine, 2-(2-thienylcarbonylamino)propanoic acid