CAS 923010-75-7 is the registry number for 2-Amino-4,7-dihydro-5h-thieno[2,3-c]pyran-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid (CAS 923010-75-7) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid. InChIKey: PISWGKLHWQOPNZ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid |
| InChIKey | PISWGKLHWQOPNZ-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1C(=C(S2)N)C(=O)O |
Computed by PubChem (NCBI)