cas: 21626-70-0 — see every product listed under this CAS number, including other names
4-(Morpholinosulfonyl)aniline, 97% (CAS 21626-70-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | TL00826DA |
| cas | 21626-70-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 143.05 Pln | |
| Thermo Scientific | 5g | 411.85 Pln | |
| Thermo Scientific | 10g | 677.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-morpholin-4-ylsulfonylaniline (CAS 21626-70-0) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 4-morpholin-4-ylsulfonylaniline. InChIKey: FTKHPQFFQRKOJC-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 4-morpholin-4-ylsulfonylaniline |
| InChIKey | FTKHPQFFQRKOJC-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)