cas: 21626-70-0 — see every product listed under this CAS number, including other names
Benzenamine, 4-(4-morpholinylsulfonyl)-, 98%, 98% (CAS 21626-70-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCMV-250mg |
| cas | 21626-70-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 314.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-morpholin-4-ylsulfonylaniline (CAS 21626-70-0) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 4-morpholin-4-ylsulfonylaniline. InChIKey: FTKHPQFFQRKOJC-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 4-morpholin-4-ylsulfonylaniline |
| InChIKey | FTKHPQFFQRKOJC-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)