cas: 1233249-35-8 — see every product listed under this CAS number, including other names
4-(N-BOC-Aminophenyl)acetonitrile, 98%, 98% (CAS 1233249-35-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110X39-1g |
| cas | 1233249-35-8 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1370.00 Pln | |
| Chemat | 10g | 2354.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-(cyanomethyl)phenyl]carbamate (CAS 1233249-35-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl N-[4-(cyanomethyl)phenyl]carbamate. InChIKey: RMXGPJWRYXDDCW-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl N-[4-(cyanomethyl)phenyl]carbamate |
| InChIKey | RMXGPJWRYXDDCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CC#N |
Computed by PubChem (NCBI)