CAS 167954-49-6 appears in our catalog under these names: (1H-Indol-2-yl)-carbamic acid tert-butyl ester, 95%, tert–Butyl (1H–indol–2–yl)carbamate, Carbamic acid, 1H-indol-2-yl-, 1,1-dimethylethyl ester, 98%, 98%, 1H-INDOL-2-YL-CARBAMIC ACID 1,1-DIMETHYLETHYL ESTER, 98%, tert-Butyl 1H-indol-2-ylcarbamate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
Tert-butyl N-(1H-indol-2-yl)carbamate (CAS 167954-49-6) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl N-(1H-indol-2-yl)carbamate. InChIKey: KSBPWHKOKZZKKY-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl N-(1H-indol-2-yl)carbamate |
| InChIKey | KSBPWHKOKZZKKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)