CAS 1164512-84-8 appears in our catalog under these names: (2E)-2-Cyano-3-(2,5-dimethyl-1-propyl-1h-pyrrol-3-yl)acrylic acid, 95%, (E)-2-Cyano-3-(2,5-dimethyl-1-propyl-1H-pyrrol-3-yl)acrylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoic acid (CAS 1164512-84-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoic acid. InChIKey: FHQPESYLSVCTMT-KPKJPENVSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoic acid |
| InChIKey | FHQPESYLSVCTMT-KPKJPENVSA-N |
| SMILES | CCCN1C(=CC(=C1C)/C=C(\C#N)/C(=O)O)C |
Computed by PubChem (NCBI)