CAS 885273-73-4 appears in our catalog under these names: 6-Boc-amino-1h-indole, 95%, tert-Butyl 1H-indol-6-ylcarbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl N-(1H-indol-6-yl)carbamate (CAS 885273-73-4) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl N-(1H-indol-6-yl)carbamate. InChIKey: DVDFTRSGEMTSAL-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl N-(1H-indol-6-yl)carbamate |
| InChIKey | DVDFTRSGEMTSAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(C=C1)C=CN2 |
Computed by PubChem (NCBI)