Products 1799434-56-2

CAS 1799434-56-2 is the registry number for 2-tert-Butyl-3-methyl-2h-indazole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-tert-butyl-3-methylindazole-6-carboxylic acid (CAS 1799434-56-2) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: 2-tert-butyl-3-methylindazole-6-carboxylic acid. InChIKey: GACXVVKHDZMILT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16N2O2
Molecular weight232.28 g/mol
IUPAC name2-tert-butyl-3-methylindazole-6-carboxylic acid
InChIKeyGACXVVKHDZMILT-UHFFFAOYSA-N
SMILESCC1=C2C=CC(=CC2=NN1C(C)(C)C)C(=O)O

Computed by PubChem (NCBI)