cas: 850568-12-6 — see every product listed under this CAS number, including other names
4-(N-Ethylaminocarbonyl)phenylboronic acid, 95%, 95% (CAS 850568-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119GTM-250mg |
| cas | 850568-12-6 |
| size | 250mg |
| availability | 14.79g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(ethylcarbamoyl)phenyl]boronic acid (CAS 850568-12-6) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: [4-(ethylcarbamoyl)phenyl]boronic acid. InChIKey: DONAYSCOAAAZKS-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | [4-(ethylcarbamoyl)phenyl]boronic acid |
| InChIKey | DONAYSCOAAAZKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC)(O)O |
Computed by PubChem (NCBI)