CAS 1621416-45-2 is the registry number for 2-(Cyclopropylmethoxy)pyridine-3-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-(cyclopropylmethoxy)-3-pyridinyl]boronic acid (CAS 1621416-45-2) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: [2-(cyclopropylmethoxy)-3-pyridinyl]boronic acid. InChIKey: OLXQVSPUBVQZSS-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | [2-(cyclopropylmethoxy)-3-pyridinyl]boronic acid |
| InChIKey | OLXQVSPUBVQZSS-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OCC2CC2)(O)O |
Computed by PubChem (NCBI)