Products 1060661-55-3
CAS 1060661-55-3 appears in our catalog under these names: 5-Acetamido-2-methylphenylboronic acid, 98%, (5-Acetamido-2-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
(5-acetamido-2-methylphenyl)boronic acid (CAS 1060661-55-3) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: (5-acetamido-2-methylphenyl)boronic acid. InChIKey: YJBSHDWYEWWMNT-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | (5-acetamido-2-methylphenyl)boronic acid |
| InChIKey | YJBSHDWYEWWMNT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)NC(=O)C)C)(O)O |
Computed by PubChem (NCBI)