CAS 874219-16-6 appears in our catalog under these names: 2-(N,N-Dimethylaminocarbonyl)phenylboronic acid, 95%, 2-(Dimethylcarbamoyl)benzeneboronic acid, 95% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 1g, 250mg.
[2-(dimethylcarbamoyl)phenyl]boronic acid (CAS 874219-16-6) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: [2-(dimethylcarbamoyl)phenyl]boronic acid. InChIKey: NZIOVLXULSCCSG-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | [2-(dimethylcarbamoyl)phenyl]boronic acid |
| InChIKey | NZIOVLXULSCCSG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)