CAS 850568-12-6 appears in our catalog under these names: 4-(N-Ethylaminocarbonyl)phenylboronic acid, 98%, 4-(N-Ethylaminocarbonyl)phenylboronic acid 98%, 4-(N-Ethylaminocarbonyl)phenylboronic acid, 95%, 95%, 4-(N-Ethylaminocarbonyl)phenylboronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g.
[4-(ethylcarbamoyl)phenyl]boronic acid (CAS 850568-12-6) is a chemical compound with the molecular formula C9H12BNO3 and a molecular weight of 193.01 g/mol. IUPAC name: [4-(ethylcarbamoyl)phenyl]boronic acid. InChIKey: DONAYSCOAAAZKS-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO3 |
|---|---|
| Molecular weight | 193.01 g/mol |
| IUPAC name | [4-(ethylcarbamoyl)phenyl]boronic acid |
| InChIKey | DONAYSCOAAAZKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC)(O)O |
Computed by PubChem (NCBI)