cas: 34562-97-5 — see every product listed under this CAS number, including other names
4-(Nicotinamido)butanoic acid, 98%, 98% (CAS 34562-97-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7TW-250mg |
| cas | 34562-97-5 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 942.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(pyridine-3-carbonylamino)butanoic acid (CAS 34562-97-5) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(pyridine-3-carbonylamino)butanoic acid. InChIKey: NAJVRARAUNYNDX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(pyridine-3-carbonylamino)butanoic acid |
| InChIKey | NAJVRARAUNYNDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)