cas: 34562-97-5 — see every product listed under this CAS number, including other names
4-(Nicotinamido)butanoic acid, 98% (CAS 34562-97-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 500mg, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240109-1G |
| cas | 34562-97-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 154.13 Pln | |
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 500mg | 154.13 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 601.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(pyridine-3-carbonylamino)butanoic acid (CAS 34562-97-5) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(pyridine-3-carbonylamino)butanoic acid. InChIKey: NAJVRARAUNYNDX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(pyridine-3-carbonylamino)butanoic acid |
| InChIKey | NAJVRARAUNYNDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)