cas: 50262-46-9 — see every product listed under this CAS number, including other names
4-(Nonyloxy)benzaldehyde 97% (CAS 50262-46-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A588758-250mg |
| cas | 50262-46-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 832.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A588758 |
4-nonoxybenzaldehyde (CAS 50262-46-9) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 4-nonoxybenzaldehyde. InChIKey: OZWJLGGZWZZBKK-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 4-nonoxybenzaldehyde |
| InChIKey | OZWJLGGZWZZBKK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)