cas: 50262-46-9 — see every product listed under this CAS number, including other names
4-n-Nonyloxybenzaldehyde, 97%, 97% (CAS 50262-46-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LX1-250mg |
| cas | 50262-46-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 702.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-nonoxybenzaldehyde (CAS 50262-46-9) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 4-nonoxybenzaldehyde. InChIKey: OZWJLGGZWZZBKK-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 4-nonoxybenzaldehyde |
| InChIKey | OZWJLGGZWZZBKK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)